C26H36N6O6 — CID 166132572
3,3-dimethylhexanoic acid;N-(2,6-dioxopiperidin-3-yl)-2-formyl-N-methyl-6-[(1-methyltriazol-4-yl)methylamino]benzamide (PubChem CID 166132572) has the molecular formula C26H36N6O6 and a molecular weight of 528.61 g/mol. Its IUPAC name is 3,3-dimethylhexanoic acid;N-(2,6-dioxopiperidin-3-yl)-2-formyl-N-methyl-6-[(1-methyltriazol-4-yl)methylamino]benzamide.
| Compound Name | 3,3-dimethylhexanoic acid;N-(2,6-dioxopiperidin-3-yl)-2-formyl-N-methyl-6-[(1-methyltriazol-4-yl)methylamino]benzamide |
|---|---|
| PubChem CID | 166132572 |
| Molecular Formula | C26H36N6O6 |
| Molecular Weight | 528.61 g/mol |
| Exact Mass | 528.27 |
| IUPAC Name | 3,3-dimethylhexanoic acid;N-(2,6-dioxopiperidin-3-yl)-2-formyl-N-methyl-6-[(1-methyltriazol-4-yl)methylamino]benzamide |
| SMILES | CCCC(C)(C)CC(=O)O.CN(C(=O)c1c(C=O)cccc1NCc1cn(C)nn1)C1CCC(=O)NC1=O |
| InChI | InChI=1S/C18H20N6O4.C8H16O2/c1-23-9-12(21-22-23)8-19-13-5-3-4-11(10-25)16(13)18(28)24(2)14-6-7-15(26)20-17(14)27;1-4-5-8(2,3)6-7(9)10/h3-5,9-10,14,19H,6-8H2,1-2H3,(H,20,26,27);4-6H2,1-3H3,(H,9,10) |
| InChIKey | ZRNRMPOPWVZAMC-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 163.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.61 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|