C27H33N5O5 — CID 170979687
N-(2,6-dioxopiperidin-3-yl)-2-formyl-N-methyl-6-(methylamino)benzamide;4-(piperazin-1-ylmethyl)benzaldehyde (PubChem CID 170979687) has the molecular formula C27H33N5O5 and a molecular weight of 507.59 g/mol. Its IUPAC name is N-(2,6-dioxopiperidin-3-yl)-2-formyl-N-methyl-6-(methylamino)benzamide;4-(piperazin-1-ylmethyl)benzaldehyde.
| Compound Name | N-(2,6-dioxopiperidin-3-yl)-2-formyl-N-methyl-6-(methylamino)benzamide;4-(piperazin-1-ylmethyl)benzaldehyde |
|---|---|
| PubChem CID | 170979687 |
| Molecular Formula | C27H33N5O5 |
| Molecular Weight | 507.59 g/mol |
| Exact Mass | 507.25 |
| IUPAC Name | N-(2,6-dioxopiperidin-3-yl)-2-formyl-N-methyl-6-(methylamino)benzamide;4-(piperazin-1-ylmethyl)benzaldehyde |
| SMILES | CNc1cccc(C=O)c1C(=O)N(C)C1CCC(=O)NC1=O.O=Cc1ccc(CN2CCNCC2)cc1 |
| InChI | InChI=1S/C15H17N3O4.C12H16N2O/c1-16-10-5-3-4-9(8-19)13(10)15(22)18(2)11-6-7-12(20)17-14(11)21;15-10-12-3-1-11(2-4-12)9-14-7-5-13-6-8-14/h3-5,8,11,16H,6-7H2,1-2H3,(H,17,20,21);1-4,10,13H,5-9H2 |
| InChIKey | ZKYLYLBNPYEYQS-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 127.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.59 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|