C31H41N5O5 — CID 174336036
5-[4-[[4-[[2-[[(2,6-dioxopiperidin-3-yl)-formylamino]methyl]-3-methylanilino]methyl]phenyl]methyl]piperazin-1-yl]pentanoic acid (PubChem CID 174336036) has the molecular formula C31H41N5O5 and a molecular weight of 563.70 g/mol. Its IUPAC name is 5-[4-[[4-[[2-[[(2,6-dioxopiperidin-3-yl)-formylamino]methyl]-3-methylanilino]methyl]phenyl]methyl]piperazin-1-yl]pentanoic acid.
| Compound Name | 5-[4-[[4-[[2-[[(2,6-dioxopiperidin-3-yl)-formylamino]methyl]-3-methylanilino]methyl]phenyl]methyl]piperazin-1-yl]pentanoic acid |
|---|---|
| PubChem CID | 174336036 |
| Molecular Formula | C31H41N5O5 |
| Molecular Weight | 563.70 g/mol |
| Exact Mass | 563.31 |
| IUPAC Name | 5-[4-[[4-[[2-[[(2,6-dioxopiperidin-3-yl)-formylamino]methyl]-3-methylanilino]methyl]phenyl]methyl]piperazin-1-yl]pentanoic acid |
| SMILES | Cc1cccc(NCc2ccc(CN3CCN(CCCCC(=O)O)CC3)cc2)c1CN(C=O)C1CCC(=O)NC1=O |
| InChI | InChI=1S/C31H41N5O5/c1-23-5-4-6-27(26(23)21-36(22-37)28-12-13-29(38)33-31(28)41)32-19-24-8-10-25(11-9-24)20-35-17-15-34(16-18-35)14-3-2-7-30(39)40/h4-6,8-11,22,28,32H,2-3,7,12-21H2,1H3,(H,39,40)(H,33,38,41) |
| InChIKey | GDIXPELRCMACEK-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 122.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.70 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|