C33H46N6O3 — CID 177202270
N-(2,6-dioxopiperidin-3-yl)-N-[[2-methyl-5-[4-[[1-[[3-(methylaminomethyl)phenyl]methyl]piperidin-4-yl]methyl]piperazin-1-yl]phenyl]methyl]formamide (PubChem CID 177202270) has the molecular formula C33H46N6O3 and a molecular weight of 574.77 g/mol. Its IUPAC name is N-(2,6-dioxopiperidin-3-yl)-N-[[2-methyl-5-[4-[[1-[[3-(methylaminomethyl)phenyl]methyl]piperidin-4-yl]methyl]piperazin-1-yl]phenyl]methyl]formamide.
| Compound Name | N-(2,6-dioxopiperidin-3-yl)-N-[[2-methyl-5-[4-[[1-[[3-(methylaminomethyl)phenyl]methyl]piperidin-4-yl]methyl]piperazin-1-yl]phenyl]methyl]formamide |
|---|---|
| PubChem CID | 177202270 |
| Molecular Formula | C33H46N6O3 |
| Molecular Weight | 574.77 g/mol |
| Exact Mass | 574.36 |
| IUPAC Name | N-(2,6-dioxopiperidin-3-yl)-N-[[2-methyl-5-[4-[[1-[[3-(methylaminomethyl)phenyl]methyl]piperidin-4-yl]methyl]piperazin-1-yl]phenyl]methyl]formamide |
| SMILES | CNCc1cccc(CN2CCC(CN3CCN(c4ccc(C)c(CN(C=O)C5CCC(=O)NC5=O)c4)CC3)CC2)c1 |
| InChI | InChI=1S/C33H46N6O3/c1-25-6-7-30(19-29(25)23-39(24-40)31-8-9-32(41)35-33(31)42)38-16-14-37(15-17-38)21-26-10-12-36(13-11-26)22-28-5-3-4-27(18-28)20-34-2/h3-7,18-19,24,26,31,34H,8-17,20-23H2,1-2H3,(H,35,41,42) |
| InChIKey | NODBYXJQHZEIBJ-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 88.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.77 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|