C28H30N4O4 — CID 174283747
N-(2,6-dioxopiperidin-3-yl)-N-[[2-methyl-5-[(3S)-1-(quinolin-6-ylmethyl)pyrrolidin-3-yl]oxyphenyl]methyl]formamide (PubChem CID 174283747) has the molecular formula C28H30N4O4 and a molecular weight of 486.57 g/mol. Its IUPAC name is N-(2,6-dioxopiperidin-3-yl)-N-[[2-methyl-5-[(3S)-1-(quinolin-6-ylmethyl)pyrrolidin-3-yl]oxyphenyl]methyl]formamide.
| Compound Name | N-(2,6-dioxopiperidin-3-yl)-N-[[2-methyl-5-[(3S)-1-(quinolin-6-ylmethyl)pyrrolidin-3-yl]oxyphenyl]methyl]formamide |
|---|---|
| PubChem CID | 174283747 |
| Molecular Formula | C28H30N4O4 |
| Molecular Weight | 486.57 g/mol |
| Exact Mass | 486.23 |
| IUPAC Name | N-(2,6-dioxopiperidin-3-yl)-N-[[2-methyl-5-[(3S)-1-(quinolin-6-ylmethyl)pyrrolidin-3-yl]oxyphenyl]methyl]formamide |
| SMILES | Cc1ccc(O[C@H]2CCN(Cc3ccc4ncccc4c3)C2)cc1CN(C=O)C1CCC(=O)NC1=O |
| InChI | InChI=1S/C28H30N4O4/c1-19-4-6-23(14-22(19)16-32(18-33)26-8-9-27(34)30-28(26)35)36-24-10-12-31(17-24)15-20-5-7-25-21(13-20)3-2-11-29-25/h2-7,11,13-14,18,24,26H,8-10,12,15-17H2,1H3,(H,30,34,35)/t24-,26?/m0/s1 |
| InChIKey | SNRXOHRDDQFNNR-QSAPEBAKSA-N |
| XLogP | 2.96 |
| TPSA | 91.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.57 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|