C20H29N3O5 — CID 156711586
5-cyclobutyloxy-2-methylbenzaldehyde;N-(2,6-dioxopiperidin-3-yl)-N-methylformamide;methanamine (PubChem CID 156711586) has the molecular formula C20H29N3O5 and a molecular weight of 391.47 g/mol. Its IUPAC name is 5-cyclobutyloxy-2-methylbenzaldehyde;N-(2,6-dioxopiperidin-3-yl)-N-methylformamide;methanamine.
| Compound Name | 5-cyclobutyloxy-2-methylbenzaldehyde;N-(2,6-dioxopiperidin-3-yl)-N-methylformamide;methanamine |
|---|---|
| PubChem CID | 156711586 |
| Molecular Formula | C20H29N3O5 |
| Molecular Weight | 391.47 g/mol |
| Exact Mass | 391.21 |
| IUPAC Name | 5-cyclobutyloxy-2-methylbenzaldehyde;N-(2,6-dioxopiperidin-3-yl)-N-methylformamide;methanamine |
| SMILES | CN.CN(C=O)C1CCC(=O)NC1=O.Cc1ccc(OC2CCC2)cc1C=O |
| InChI | InChI=1S/C12H14O2.C7H10N2O3.CH5N/c1-9-5-6-12(7-10(9)8-13)14-11-3-2-4-11;1-9(4-10)5-2-3-6(11)8-7(5)12;1-2/h5-8,11H,2-4H2,1H3;4-5H,2-3H2,1H3,(H,8,11,12);2H2,1H3 |
| InChIKey | HQBDHLKZSYYANN-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 118.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.47 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|