C15H18N2O5 — CID 177010821
N-(2,3-dimethoxy-4-methylphenyl)-N-(2,6-dioxopiperidin-3-yl)formamide (PubChem CID 177010821) has the molecular formula C15H18N2O5 and a molecular weight of 306.32 g/mol. Its IUPAC name is N-(2,3-dimethoxy-4-methylphenyl)-N-(2,6-dioxopiperidin-3-yl)formamide.
| Compound Name | N-(2,3-dimethoxy-4-methylphenyl)-N-(2,6-dioxopiperidin-3-yl)formamide |
|---|---|
| PubChem CID | 177010821 |
| Molecular Formula | C15H18N2O5 |
| Molecular Weight | 306.32 g/mol |
| Exact Mass | 306.12 |
| IUPAC Name | N-(2,3-dimethoxy-4-methylphenyl)-N-(2,6-dioxopiperidin-3-yl)formamide |
| SMILES | COc1c(C)ccc(N(C=O)C2CCC(=O)NC2=O)c1OC |
| InChI | InChI=1S/C15H18N2O5/c1-9-4-5-10(14(22-3)13(9)21-2)17(8-18)11-6-7-12(19)16-15(11)20/h4-5,8,11H,6-7H2,1-3H3,(H,16,19,20) |
| InChIKey | MHBCHEMFXHQRHG-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.32 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|