C19H26N4O4 — CID 176963217
N-[2-(dimethylamino)-4-(4-hydroxypiperidin-1-yl)phenyl]-N-(2,6-dioxopiperidin-3-yl)formamide (PubChem CID 176963217) has the molecular formula C19H26N4O4 and a molecular weight of 374.44 g/mol. Its IUPAC name is N-[2-(dimethylamino)-4-(4-hydroxypiperidin-1-yl)phenyl]-N-(2,6-dioxopiperidin-3-yl)formamide.
| Compound Name | N-[2-(dimethylamino)-4-(4-hydroxypiperidin-1-yl)phenyl]-N-(2,6-dioxopiperidin-3-yl)formamide |
|---|---|
| PubChem CID | 176963217 |
| Molecular Formula | C19H26N4O4 |
| Molecular Weight | 374.44 g/mol |
| Exact Mass | 374.20 |
| IUPAC Name | N-[2-(dimethylamino)-4-(4-hydroxypiperidin-1-yl)phenyl]-N-(2,6-dioxopiperidin-3-yl)formamide |
| SMILES | CN(C)c1cc(N2CCC(O)CC2)ccc1N(C=O)C1CCC(=O)NC1=O |
| InChI | InChI=1S/C19H26N4O4/c1-21(2)17-11-13(22-9-7-14(25)8-10-22)3-4-15(17)23(12-24)16-5-6-18(26)20-19(16)27/h3-4,11-12,14,16,25H,5-10H2,1-2H3,(H,20,26,27) |
| InChIKey | OGCISQRVKGXVIO-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 93.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.44 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|