C24H34FN5O3 — CID 172591262
3-[2-ethenoxy-4-[4-[(4-fluoropiperazin-1-yl)methyl]piperidin-1-yl]-N-methylanilino]piperidine-2,6-dione (PubChem CID 172591262) has the molecular formula C24H34FN5O3 and a molecular weight of 459.57 g/mol. Its IUPAC name is 3-[2-ethenoxy-4-[4-[(4-fluoropiperazin-1-yl)methyl]piperidin-1-yl]-N-methylanilino]piperidine-2,6-dione.
| Compound Name | 3-[2-ethenoxy-4-[4-[(4-fluoropiperazin-1-yl)methyl]piperidin-1-yl]-N-methylanilino]piperidine-2,6-dione |
|---|---|
| PubChem CID | 172591262 |
| Molecular Formula | C24H34FN5O3 |
| Molecular Weight | 459.57 g/mol |
| Exact Mass | 459.26 |
| IUPAC Name | 3-[2-ethenoxy-4-[4-[(4-fluoropiperazin-1-yl)methyl]piperidin-1-yl]-N-methylanilino]piperidine-2,6-dione |
| SMILES | C=COc1cc(N2CCC(CN3CCN(F)CC3)CC2)ccc1N(C)C1CCC(=O)NC1=O |
| InChI | InChI=1S/C24H34FN5O3/c1-3-33-22-16-19(4-5-20(22)27(2)21-6-7-23(31)26-24(21)32)29-10-8-18(9-11-29)17-28-12-14-30(25)15-13-28/h3-5,16,18,21H,1,6-15,17H2,2H3,(H,26,31,32) |
| InChIKey | DODJKIAKWIFAAN-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 68.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.57 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|