C31H45F2N5O4 — CID 167463692
tert-butyl N-[7-[[1-[4-[(2,6-dioxopiperidin-3-yl)-methylamino]-2,6-difluorophenyl]piperidin-4-yl]methyl]-7-azaspiro[3.5]nonan-2-yl]carbamate (PubChem CID 167463692) has the molecular formula C31H45F2N5O4 and a molecular weight of 589.73 g/mol. Its IUPAC name is tert-butyl N-[7-[[1-[4-[(2,6-dioxopiperidin-3-yl)-methylamino]-2,6-difluorophenyl]piperidin-4-yl]methyl]-7-azaspiro[3.5]nonan-2-yl]carbamate.
| Compound Name | tert-butyl N-[7-[[1-[4-[(2,6-dioxopiperidin-3-yl)-methylamino]-2,6-difluorophenyl]piperidin-4-yl]methyl]-7-azaspiro[3.5]nonan-2-yl]carbamate |
|---|---|
| PubChem CID | 167463692 |
| Molecular Formula | C31H45F2N5O4 |
| Molecular Weight | 589.73 g/mol |
| Exact Mass | 589.34 |
| IUPAC Name | tert-butyl N-[7-[[1-[4-[(2,6-dioxopiperidin-3-yl)-methylamino]-2,6-difluorophenyl]piperidin-4-yl]methyl]-7-azaspiro[3.5]nonan-2-yl]carbamate |
| SMILES | CN(c1cc(F)c(N2CCC(CN3CCC4(CC3)CC(NC(=O)OC(C)(C)C)C4)CC2)c(F)c1)C1CCC(=O)NC1=O |
| InChI | InChI=1S/C31H45F2N5O4/c1-30(2,3)42-29(41)34-21-17-31(18-21)9-13-37(14-10-31)19-20-7-11-38(12-8-20)27-23(32)15-22(16-24(27)33)36(4)25-5-6-26(39)35-28(25)40/h15-16,20-21,25H,5-14,17-19H2,1-4H3,(H,34,41)(H,35,39,40) |
| InChIKey | ZENGWLBXEXOAGA-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 94.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.73 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|