C32H47N5O5 — CID 167300759
tert-butyl 4-[[2-[4-[[(2,6-dioxopiperidin-3-yl)-methylamino]methyl]-3-formylphenyl]-2,7-diazaspiro[3.5]nonan-7-yl]methyl]piperidine-1-carboxylate (PubChem CID 167300759) has the molecular formula C32H47N5O5 and a molecular weight of 581.76 g/mol. Its IUPAC name is tert-butyl 4-[[2-[4-[[(2,6-dioxopiperidin-3-yl)-methylamino]methyl]-3-formylphenyl]-2,7-diazaspiro[3.5]nonan-7-yl]methyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[[2-[4-[[(2,6-dioxopiperidin-3-yl)-methylamino]methyl]-3-formylphenyl]-2,7-diazaspiro[3.5]nonan-7-yl]methyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 167300759 |
| Molecular Formula | C32H47N5O5 |
| Molecular Weight | 581.76 g/mol |
| Exact Mass | 581.36 |
| IUPAC Name | tert-butyl 4-[[2-[4-[[(2,6-dioxopiperidin-3-yl)-methylamino]methyl]-3-formylphenyl]-2,7-diazaspiro[3.5]nonan-7-yl]methyl]piperidine-1-carboxylate |
| SMILES | CN(Cc1ccc(N2CC3(CCN(CC4CCN(C(=O)OC(C)(C)C)CC4)CC3)C2)cc1C=O)C1CCC(=O)NC1=O |
| InChI | InChI=1S/C32H47N5O5/c1-31(2,3)42-30(41)36-13-9-23(10-14-36)18-35-15-11-32(12-16-35)21-37(22-32)26-6-5-24(25(17-26)20-38)19-34(4)27-7-8-28(39)33-29(27)40/h5-6,17,20,23,27H,7-16,18-19,21-22H2,1-4H3,(H,33,39,40) |
| InChIKey | SYKPNILATCOIPK-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 102.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.76 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|