C28H39N5O6 — CID 178155544
tert-butyl 4-[[4-[4-[(2,6-dioxopiperidin-3-yl)carbamoyl]-3-formylphenyl]piperazin-1-yl]methyl]piperidine-1-carboxylate (PubChem CID 178155544) has the molecular formula C28H39N5O6 and a molecular weight of 541.65 g/mol. Its IUPAC name is tert-butyl 4-[[4-[4-[(2,6-dioxopiperidin-3-yl)carbamoyl]-3-formylphenyl]piperazin-1-yl]methyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[[4-[4-[(2,6-dioxopiperidin-3-yl)carbamoyl]-3-formylphenyl]piperazin-1-yl]methyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 178155544 |
| Molecular Formula | C28H39N5O6 |
| Molecular Weight | 541.65 g/mol |
| Exact Mass | 541.29 |
| IUPAC Name | tert-butyl 4-[[4-[4-[(2,6-dioxopiperidin-3-yl)carbamoyl]-3-formylphenyl]piperazin-1-yl]methyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(CN2CCN(c3ccc(C(=O)NC4CCC(=O)NC4=O)c(C=O)c3)CC2)CC1 |
| InChI | InChI=1S/C28H39N5O6/c1-28(2,3)39-27(38)33-10-8-19(9-11-33)17-31-12-14-32(15-13-31)21-4-5-22(20(16-21)18-34)25(36)29-23-6-7-24(35)30-26(23)37/h4-5,16,18-19,23H,6-15,17H2,1-3H3,(H,29,36)(H,30,35,37) |
| InChIKey | ASMVHYJIMXVCSM-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 128.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.65 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|