C29H40N4O6 — CID 167190482
tert-butyl 1-[[1-[4-[(2,6-dioxopiperidin-3-yl)-methylcarbamoyl]-3-formylphenyl]pyrrolidin-3-yl]methyl]piperidine-4-carboxylate (PubChem CID 167190482) has the molecular formula C29H40N4O6 and a molecular weight of 540.66 g/mol. Its IUPAC name is tert-butyl 1-[[1-[4-[(2,6-dioxopiperidin-3-yl)-methylcarbamoyl]-3-formylphenyl]pyrrolidin-3-yl]methyl]piperidine-4-carboxylate.
| Compound Name | tert-butyl 1-[[1-[4-[(2,6-dioxopiperidin-3-yl)-methylcarbamoyl]-3-formylphenyl]pyrrolidin-3-yl]methyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 167190482 |
| Molecular Formula | C29H40N4O6 |
| Molecular Weight | 540.66 g/mol |
| Exact Mass | 540.29 |
| IUPAC Name | tert-butyl 1-[[1-[4-[(2,6-dioxopiperidin-3-yl)-methylcarbamoyl]-3-formylphenyl]pyrrolidin-3-yl]methyl]piperidine-4-carboxylate |
| SMILES | CN(C(=O)c1ccc(N2CCC(CN3CCC(C(=O)OC(C)(C)C)CC3)C2)cc1C=O)C1CCC(=O)NC1=O |
| InChI | InChI=1S/C29H40N4O6/c1-29(2,3)39-28(38)20-10-12-32(13-11-20)16-19-9-14-33(17-19)22-5-6-23(21(15-22)18-34)27(37)31(4)24-7-8-25(35)30-26(24)36/h5-6,15,18-20,24H,7-14,16-17H2,1-4H3,(H,30,35,36) |
| InChIKey | AAJDRFYTWAAING-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 116.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.66 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|