C30H38N6O4 — CID 176966871
5-[4-[[4-(4-aminophenyl)piperazin-1-yl]methyl]piperidin-1-yl]-N-(2,6-dioxopiperidin-3-yl)-2-formyl-N-methylbenzamide (PubChem CID 176966871) has the molecular formula C30H38N6O4 and a molecular weight of 546.67 g/mol. Its IUPAC name is 5-[4-[[4-(4-aminophenyl)piperazin-1-yl]methyl]piperidin-1-yl]-N-(2,6-dioxopiperidin-3-yl)-2-formyl-N-methylbenzamide.
| Compound Name | 5-[4-[[4-(4-aminophenyl)piperazin-1-yl]methyl]piperidin-1-yl]-N-(2,6-dioxopiperidin-3-yl)-2-formyl-N-methylbenzamide |
|---|---|
| PubChem CID | 176966871 |
| Molecular Formula | C30H38N6O4 |
| Molecular Weight | 546.67 g/mol |
| Exact Mass | 546.30 |
| IUPAC Name | 5-[4-[[4-(4-aminophenyl)piperazin-1-yl]methyl]piperidin-1-yl]-N-(2,6-dioxopiperidin-3-yl)-2-formyl-N-methylbenzamide |
| SMILES | CN(C(=O)c1cc(N2CCC(CN3CCN(c4ccc(N)cc4)CC3)CC2)ccc1C=O)C1CCC(=O)NC1=O |
| InChI | InChI=1S/C30H38N6O4/c1-33(27-8-9-28(38)32-29(27)39)30(40)26-18-25(5-2-22(26)20-37)35-12-10-21(11-13-35)19-34-14-16-36(17-15-34)24-6-3-23(31)4-7-24/h2-7,18,20-21,27H,8-17,19,31H2,1H3,(H,32,38,39) |
| InChIKey | LUTVSQTUGCRFOZ-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 119.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.67 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|