C45H52N6O4 — CID 155213483
N-(2,6-dioxopiperidin-3-yl)-2-[4-[4-[[1-[4-[(E)-1-(4-hydroxyphenyl)-2-phenylbut-1-enyl]phenyl]piperidin-4-yl]methyl]piperazin-1-yl]-2-pyridinyl]-N-methylacetamide (PubChem CID 155213483) has the molecular formula C45H52N6O4 and a molecular weight of 740.95 g/mol. Its IUPAC name is N-(2,6-dioxopiperidin-3-yl)-2-[4-[4-[[1-[4-[(E)-1-(4-hydroxyphenyl)-2-phenylbut-1-enyl]phenyl]piperidin-4-yl]methyl]piperazin-1-yl]-2-pyridinyl]-N-methylacetamide.
| Compound Name | N-(2,6-dioxopiperidin-3-yl)-2-[4-[4-[[1-[4-[(E)-1-(4-hydroxyphenyl)-2-phenylbut-1-enyl]phenyl]piperidin-4-yl]methyl]piperazin-1-yl]-2-pyridinyl]-N-methylacetamide |
|---|---|
| PubChem CID | 155213483 |
| Molecular Formula | C45H52N6O4 |
| Molecular Weight | 740.95 g/mol |
| Exact Mass | 740.41 |
| IUPAC Name | N-(2,6-dioxopiperidin-3-yl)-2-[4-[4-[[1-[4-[(E)-1-(4-hydroxyphenyl)-2-phenylbut-1-enyl]phenyl]piperidin-4-yl]methyl]piperazin-1-yl]-2-pyridinyl]-N-methylacetamide |
| SMILES | CC/C(=C(\c1ccc(O)cc1)c1ccc(N2CCC(CN3CCN(c4ccnc(CC(=O)N(C)C5CCC(=O)NC5=O)c4)CC3)CC2)cc1)c1ccccc1 |
| InChI | InChI=1S/C45H52N6O4/c1-3-40(33-7-5-4-6-8-33)44(35-11-15-39(52)16-12-35)34-9-13-37(14-10-34)50-23-20-32(21-24-50)31-49-25-27-51(28-26-49)38-19-22-46-36(29-38)30-43(54)48(2)41-17-18-42(53)47-45(41)55/h4-16,19,22,29,32,41,52H,3,17-18,20-21,23-28,30-31H2,1-2H3,(H,47,53,55)/b44-40+ |
| InChIKey | KYFBUVUHLCRHEY-NECFUIDXSA-N |
| XLogP | 6.00 |
| TPSA | 109.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 740.95 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|