C22H32N6O3 — CID 167463620
3-[4-[(1-aminopiperidin-4-yl)methyl]piperazin-1-yl]-N-(2,6-dioxopiperidin-3-yl)benzamide (PubChem CID 167463620) has the molecular formula C22H32N6O3 and a molecular weight of 428.54 g/mol. Its IUPAC name is 3-[4-[(1-aminopiperidin-4-yl)methyl]piperazin-1-yl]-N-(2,6-dioxopiperidin-3-yl)benzamide.
| Compound Name | 3-[4-[(1-aminopiperidin-4-yl)methyl]piperazin-1-yl]-N-(2,6-dioxopiperidin-3-yl)benzamide |
|---|---|
| PubChem CID | 167463620 |
| Molecular Formula | C22H32N6O3 |
| Molecular Weight | 428.54 g/mol |
| Exact Mass | 428.25 |
| IUPAC Name | 3-[4-[(1-aminopiperidin-4-yl)methyl]piperazin-1-yl]-N-(2,6-dioxopiperidin-3-yl)benzamide |
| SMILES | NN1CCC(CN2CCN(c3cccc(C(=O)NC4CCC(=O)NC4=O)c3)CC2)CC1 |
| InChI | InChI=1S/C22H32N6O3/c23-28-8-6-16(7-9-28)15-26-10-12-27(13-11-26)18-3-1-2-17(14-18)21(30)24-19-4-5-20(29)25-22(19)31/h1-3,14,16,19H,4-13,15,23H2,(H,24,30)(H,25,29,31) |
| InChIKey | MPJCPTJDJFMBCT-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 111.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.54 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|