C20H30N6O2 — CID 177300792
3-[[5-[4-(piperidin-4-ylmethyl)piperazin-1-yl]-2-pyridinyl]amino]piperidine-2,6-dione (PubChem CID 177300792) has the molecular formula C20H30N6O2 and a molecular weight of 386.50 g/mol. Its IUPAC name is 3-[[5-[4-(piperidin-4-ylmethyl)piperazin-1-yl]-2-pyridinyl]amino]piperidine-2,6-dione.
| Compound Name | 3-[[5-[4-(piperidin-4-ylmethyl)piperazin-1-yl]-2-pyridinyl]amino]piperidine-2,6-dione |
|---|---|
| PubChem CID | 177300792 |
| Molecular Formula | C20H30N6O2 |
| Molecular Weight | 386.50 g/mol |
| Exact Mass | 386.24 |
| IUPAC Name | 3-[[5-[4-(piperidin-4-ylmethyl)piperazin-1-yl]-2-pyridinyl]amino]piperidine-2,6-dione |
| SMILES | O=C1CCC(Nc2ccc(N3CCN(CC4CCNCC4)CC3)cn2)C(=O)N1 |
| InChI | InChI=1S/C20H30N6O2/c27-19-4-2-17(20(28)24-19)23-18-3-1-16(13-22-18)26-11-9-25(10-12-26)14-15-5-7-21-8-6-15/h1,3,13,15,17,21H,2,4-12,14H2,(H,22,23)(H,24,27,28) |
| InChIKey | BAMOZIXBYQIFKA-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 89.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.50 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|