C22H30N6O2 — CID 177301092
5-[(2,6-dioxopiperidin-3-yl)amino]-2-[4-(piperidin-4-ylmethyl)piperazin-1-yl]benzonitrile (PubChem CID 177301092) has the molecular formula C22H30N6O2 and a molecular weight of 410.52 g/mol. Its IUPAC name is 5-[(2,6-dioxopiperidin-3-yl)amino]-2-[4-(piperidin-4-ylmethyl)piperazin-1-yl]benzonitrile.
| Compound Name | 5-[(2,6-dioxopiperidin-3-yl)amino]-2-[4-(piperidin-4-ylmethyl)piperazin-1-yl]benzonitrile |
|---|---|
| PubChem CID | 177301092 |
| Molecular Formula | C22H30N6O2 |
| Molecular Weight | 410.52 g/mol |
| Exact Mass | 410.24 |
| IUPAC Name | 5-[(2,6-dioxopiperidin-3-yl)amino]-2-[4-(piperidin-4-ylmethyl)piperazin-1-yl]benzonitrile |
| SMILES | N#Cc1cc(NC2CCC(=O)NC2=O)ccc1N1CCN(CC2CCNCC2)CC1 |
| InChI | InChI=1S/C22H30N6O2/c23-14-17-13-18(25-19-2-4-21(29)26-22(19)30)1-3-20(17)28-11-9-27(10-12-28)15-16-5-7-24-8-6-16/h1,3,13,16,19,24-25H,2,4-12,15H2,(H,26,29,30) |
| InChIKey | VLLKXDPHKOIVBG-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 100.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.52 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|