C22H30FN5O3 — CID 178081983
3-(2,6-dioxopiperidin-3-yl)-2-fluoro-4-[4-(piperidin-4-ylmethyl)piperazin-1-yl]benzamide (PubChem CID 178081983) has the molecular formula C22H30FN5O3 and a molecular weight of 431.51 g/mol. Its IUPAC name is 3-(2,6-dioxopiperidin-3-yl)-2-fluoro-4-[4-(piperidin-4-ylmethyl)piperazin-1-yl]benzamide.
| Compound Name | 3-(2,6-dioxopiperidin-3-yl)-2-fluoro-4-[4-(piperidin-4-ylmethyl)piperazin-1-yl]benzamide |
|---|---|
| PubChem CID | 178081983 |
| Molecular Formula | C22H30FN5O3 |
| Molecular Weight | 431.51 g/mol |
| Exact Mass | 431.23 |
| IUPAC Name | 3-(2,6-dioxopiperidin-3-yl)-2-fluoro-4-[4-(piperidin-4-ylmethyl)piperazin-1-yl]benzamide |
| SMILES | NC(=O)c1ccc(N2CCN(CC3CCNCC3)CC2)c(C2CCC(=O)NC2=O)c1F |
| InChI | InChI=1S/C22H30FN5O3/c23-20-16(21(24)30)1-3-17(19(20)15-2-4-18(29)26-22(15)31)28-11-9-27(10-12-28)13-14-5-7-25-8-6-14/h1,3,14-15,25H,2,4-13H2,(H2,24,30)(H,26,29,31) |
| InChIKey | FXXFPWUMEYWRNS-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 107.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.51 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|