C23H32N6O2 — CID 170433398
3-[1-methyl-7-[4-(piperidin-4-ylmethyl)piperazin-1-yl]indazol-3-yl]piperidine-2,6-dione (PubChem CID 170433398) has the molecular formula C23H32N6O2 and a molecular weight of 424.55 g/mol. Its IUPAC name is 3-[1-methyl-7-[4-(piperidin-4-ylmethyl)piperazin-1-yl]indazol-3-yl]piperidine-2,6-dione.
| Compound Name | 3-[1-methyl-7-[4-(piperidin-4-ylmethyl)piperazin-1-yl]indazol-3-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 170433398 |
| Molecular Formula | C23H32N6O2 |
| Molecular Weight | 424.55 g/mol |
| Exact Mass | 424.26 |
| IUPAC Name | 3-[1-methyl-7-[4-(piperidin-4-ylmethyl)piperazin-1-yl]indazol-3-yl]piperidine-2,6-dione |
| SMILES | Cn1nc(C2CCC(=O)NC2=O)c2cccc(N3CCN(CC4CCNCC4)CC3)c21 |
| InChI | InChI=1S/C23H32N6O2/c1-27-22-17(21(26-27)18-5-6-20(30)25-23(18)31)3-2-4-19(22)29-13-11-28(12-14-29)15-16-7-9-24-10-8-16/h2-4,16,18,24H,5-15H2,1H3,(H,25,30,31) |
| InChIKey | LIAFAKBKOWXHJK-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 82.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.55 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|