C24H34N6O3 — CID 170432983
3-[7-[4-[[3-(hydroxymethyl)piperazin-1-yl]methyl]piperidin-1-yl]-1-methylindazol-3-yl]piperidine-2,6-dione (PubChem CID 170432983) has the molecular formula C24H34N6O3 and a molecular weight of 454.58 g/mol. Its IUPAC name is 3-[7-[4-[[3-(hydroxymethyl)piperazin-1-yl]methyl]piperidin-1-yl]-1-methylindazol-3-yl]piperidine-2,6-dione.
| Compound Name | 3-[7-[4-[[3-(hydroxymethyl)piperazin-1-yl]methyl]piperidin-1-yl]-1-methylindazol-3-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 170432983 |
| Molecular Formula | C24H34N6O3 |
| Molecular Weight | 454.58 g/mol |
| Exact Mass | 454.27 |
| IUPAC Name | 3-[7-[4-[[3-(hydroxymethyl)piperazin-1-yl]methyl]piperidin-1-yl]-1-methylindazol-3-yl]piperidine-2,6-dione |
| SMILES | Cn1nc(C2CCC(=O)NC2=O)c2cccc(N3CCC(CN4CCNC(CO)C4)CC3)c21 |
| InChI | InChI=1S/C24H34N6O3/c1-28-23-18(22(27-28)19-5-6-21(32)26-24(19)33)3-2-4-20(23)30-10-7-16(8-11-30)13-29-12-9-25-17(14-29)15-31/h2-4,16-17,19,25,31H,5-15H2,1H3,(H,26,32,33) |
| InChIKey | QIECYOXWECNKBZ-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 102.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.58 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|