C29H35ClIN7O3 — CID 170433318
3-[7-[4-[[4-(5-chloro-4-iodo-2-pyridinyl)-2-(hydroxymethyl)piperazin-1-yl]methyl]piperidin-1-yl]-1-methylindazol-3-yl]piperidine-2,6-dione (PubChem CID 170433318) has the molecular formula C29H35ClIN7O3 and a molecular weight of 692.00 g/mol. Its IUPAC name is 3-[7-[4-[[4-(5-chloro-4-iodo-2-pyridinyl)-2-(hydroxymethyl)piperazin-1-yl]methyl]piperidin-1-yl]-1-methylindazol-3-yl]piperidine-2,6-dione.
| Compound Name | 3-[7-[4-[[4-(5-chloro-4-iodo-2-pyridinyl)-2-(hydroxymethyl)piperazin-1-yl]methyl]piperidin-1-yl]-1-methylindazol-3-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 170433318 |
| Molecular Formula | C29H35ClIN7O3 |
| Molecular Weight | 692.00 g/mol |
| Exact Mass | 691.15 |
| IUPAC Name | 3-[7-[4-[[4-(5-chloro-4-iodo-2-pyridinyl)-2-(hydroxymethyl)piperazin-1-yl]methyl]piperidin-1-yl]-1-methylindazol-3-yl]piperidine-2,6-dione |
| SMILES | Cn1nc(C2CCC(=O)NC2=O)c2cccc(N3CCC(CN4CCN(c5cc(I)c(Cl)cn5)CC4CO)CC3)c21 |
| InChI | InChI=1S/C29H35ClIN7O3/c1-35-28-20(27(34-35)21-5-6-26(40)33-29(21)41)3-2-4-24(28)36-9-7-18(8-10-36)15-37-11-12-38(16-19(37)17-39)25-13-23(31)22(30)14-32-25/h2-4,13-14,18-19,21,39H,5-12,15-17H2,1H3,(H,33,40,41) |
| InChIKey | SHKHNICITJMXLV-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 106.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.00 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|