C22H29N5O4 — CID 170321259
tert-butyl 4-[3-(2,6-dioxopiperidin-3-yl)-1-methylindazol-7-yl]piperazine-1-carboxylate (PubChem CID 170321259) has the molecular formula C22H29N5O4 and a molecular weight of 427.51 g/mol. Its IUPAC name is tert-butyl 4-[3-(2,6-dioxopiperidin-3-yl)-1-methylindazol-7-yl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[3-(2,6-dioxopiperidin-3-yl)-1-methylindazol-7-yl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 170321259 |
| Molecular Formula | C22H29N5O4 |
| Molecular Weight | 427.51 g/mol |
| Exact Mass | 427.22 |
| IUPAC Name | tert-butyl 4-[3-(2,6-dioxopiperidin-3-yl)-1-methylindazol-7-yl]piperazine-1-carboxylate |
| SMILES | Cn1nc(C2CCC(=O)NC2=O)c2cccc(N3CCN(C(=O)OC(C)(C)C)CC3)c21 |
| InChI | InChI=1S/C22H29N5O4/c1-22(2,3)31-21(30)27-12-10-26(11-13-27)16-7-5-6-14-18(24-25(4)19(14)16)15-8-9-17(28)23-20(15)29/h5-7,15H,8-13H2,1-4H3,(H,23,28,29) |
| InChIKey | BTMVSKIPGZSXMV-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 96.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.51 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|