C26H35N5O4 — CID 170432555
tert-butyl 2-[3-(2,6-dioxopiperidin-3-yl)-1-methylindazol-7-yl]-2,7-diazaspiro[4.5]decane-7-carboxylate (PubChem CID 170432555) has the molecular formula C26H35N5O4 and a molecular weight of 481.60 g/mol. Its IUPAC name is tert-butyl 2-[3-(2,6-dioxopiperidin-3-yl)-1-methylindazol-7-yl]-2,7-diazaspiro[4.5]decane-7-carboxylate.
| Compound Name | tert-butyl 2-[3-(2,6-dioxopiperidin-3-yl)-1-methylindazol-7-yl]-2,7-diazaspiro[4.5]decane-7-carboxylate |
|---|---|
| PubChem CID | 170432555 |
| Molecular Formula | C26H35N5O4 |
| Molecular Weight | 481.60 g/mol |
| Exact Mass | 481.27 |
| IUPAC Name | tert-butyl 2-[3-(2,6-dioxopiperidin-3-yl)-1-methylindazol-7-yl]-2,7-diazaspiro[4.5]decane-7-carboxylate |
| SMILES | Cn1nc(C2CCC(=O)NC2=O)c2cccc(N3CCC4(CCCN(C(=O)OC(C)(C)C)C4)C3)c21 |
| InChI | InChI=1S/C26H35N5O4/c1-25(2,3)35-24(34)31-13-6-11-26(16-31)12-14-30(15-26)19-8-5-7-17-21(28-29(4)22(17)19)18-9-10-20(32)27-23(18)33/h5,7-8,18H,6,9-16H2,1-4H3,(H,27,32,33) |
| InChIKey | FCNCUDAUTUNJIR-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 96.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.60 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|