C21H26ClN3O4 — CID 178099304
tert-butyl 6-[2-chloro-3-(2,6-dioxopiperidin-3-yl)phenyl]-2,6-diazaspiro[3.3]heptane-2-carboxylate (PubChem CID 178099304) has the molecular formula C21H26ClN3O4 and a molecular weight of 419.91 g/mol. Its IUPAC name is tert-butyl 6-[2-chloro-3-(2,6-dioxopiperidin-3-yl)phenyl]-2,6-diazaspiro[3.3]heptane-2-carboxylate.
| Compound Name | tert-butyl 6-[2-chloro-3-(2,6-dioxopiperidin-3-yl)phenyl]-2,6-diazaspiro[3.3]heptane-2-carboxylate |
|---|---|
| PubChem CID | 178099304 |
| Molecular Formula | C21H26ClN3O4 |
| Molecular Weight | 419.91 g/mol |
| Exact Mass | 419.16 |
| IUPAC Name | tert-butyl 6-[2-chloro-3-(2,6-dioxopiperidin-3-yl)phenyl]-2,6-diazaspiro[3.3]heptane-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC2(C1)CN(c1cccc(C3CCC(=O)NC3=O)c1Cl)C2 |
| InChI | InChI=1S/C21H26ClN3O4/c1-20(2,3)29-19(28)25-11-21(12-25)9-24(10-21)15-6-4-5-13(17(15)22)14-7-8-16(26)23-18(14)27/h4-6,14H,7-12H2,1-3H3,(H,23,26,27) |
| InChIKey | KZMUXXOIRKPLLB-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.91 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|