C21H29N3O4 — CID 170979417
tert-butyl 4-[3-(2,6-dioxopiperidin-3-yl)-4-methylphenyl]piperazine-1-carboxylate (PubChem CID 170979417) has the molecular formula C21H29N3O4 and a molecular weight of 387.48 g/mol. Its IUPAC name is tert-butyl 4-[3-(2,6-dioxopiperidin-3-yl)-4-methylphenyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[3-(2,6-dioxopiperidin-3-yl)-4-methylphenyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 170979417 |
| Molecular Formula | C21H29N3O4 |
| Molecular Weight | 387.48 g/mol |
| Exact Mass | 387.22 |
| IUPAC Name | tert-butyl 4-[3-(2,6-dioxopiperidin-3-yl)-4-methylphenyl]piperazine-1-carboxylate |
| SMILES | Cc1ccc(N2CCN(C(=O)OC(C)(C)C)CC2)cc1C1CCC(=O)NC1=O |
| InChI | InChI=1S/C21H29N3O4/c1-14-5-6-15(13-17(14)16-7-8-18(25)22-19(16)26)23-9-11-24(12-10-23)20(27)28-21(2,3)4/h5-6,13,16H,7-12H2,1-4H3,(H,22,25,26) |
| InChIKey | MMLKUKFBUSYPSK-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.48 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|