C22H25ClN4O3 — CID 178099434
3-[2-chloro-3-[4-(1,6-dimethyl-2-oxo-3-pyridinyl)piperazin-1-yl]phenyl]piperidine-2,6-dione (PubChem CID 178099434) has the molecular formula C22H25ClN4O3 and a molecular weight of 428.92 g/mol. Its IUPAC name is 3-[2-chloro-3-[4-(1,6-dimethyl-2-oxo-3-pyridinyl)piperazin-1-yl]phenyl]piperidine-2,6-dione.
| Compound Name | 3-[2-chloro-3-[4-(1,6-dimethyl-2-oxo-3-pyridinyl)piperazin-1-yl]phenyl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 178099434 |
| Molecular Formula | C22H25ClN4O3 |
| Molecular Weight | 428.92 g/mol |
| Exact Mass | 428.16 |
| IUPAC Name | 3-[2-chloro-3-[4-(1,6-dimethyl-2-oxo-3-pyridinyl)piperazin-1-yl]phenyl]piperidine-2,6-dione |
| SMILES | Cc1ccc(N2CCN(c3cccc(C4CCC(=O)NC4=O)c3Cl)CC2)c(=O)n1C |
| InChI | InChI=1S/C22H25ClN4O3/c1-14-6-8-18(22(30)25(14)2)27-12-10-26(11-13-27)17-5-3-4-15(20(17)23)16-7-9-19(28)24-21(16)29/h3-6,8,16H,7,9-13H2,1-2H3,(H,24,28,29) |
| InChIKey | OBAWQSAPKYJBOY-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 74.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.92 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|