C22H23Cl2N3O2 — CID 178099235
3-[2-chloro-3-[4-[(2-chlorophenyl)methyl]piperazin-1-yl]phenyl]piperidine-2,6-dione (PubChem CID 178099235) has the molecular formula C22H23Cl2N3O2 and a molecular weight of 432.35 g/mol. Its IUPAC name is 3-[2-chloro-3-[4-[(2-chlorophenyl)methyl]piperazin-1-yl]phenyl]piperidine-2,6-dione.
| Compound Name | 3-[2-chloro-3-[4-[(2-chlorophenyl)methyl]piperazin-1-yl]phenyl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 178099235 |
| Molecular Formula | C22H23Cl2N3O2 |
| Molecular Weight | 432.35 g/mol |
| Exact Mass | 431.12 |
| IUPAC Name | 3-[2-chloro-3-[4-[(2-chlorophenyl)methyl]piperazin-1-yl]phenyl]piperidine-2,6-dione |
| SMILES | O=C1CCC(c2cccc(N3CCN(Cc4ccccc4Cl)CC3)c2Cl)C(=O)N1 |
| InChI | InChI=1S/C22H23Cl2N3O2/c23-18-6-2-1-4-15(18)14-26-10-12-27(13-11-26)19-7-3-5-16(21(19)24)17-8-9-20(28)25-22(17)29/h1-7,17H,8-14H2,(H,25,28,29) |
| InChIKey | PFBNDQZIEZDSPP-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.35 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|