C22H21ClF2N6O2 — CID 178099268
3-[2-chloro-3-[4-[5-(difluoromethyl)pyrazolo[1,5-a]pyrimidin-7-yl]piperazin-1-yl]phenyl]piperidine-2,6-dione (PubChem CID 178099268) has the molecular formula C22H21ClF2N6O2 and a molecular weight of 474.90 g/mol. Its IUPAC name is 3-[2-chloro-3-[4-[5-(difluoromethyl)pyrazolo[1,5-a]pyrimidin-7-yl]piperazin-1-yl]phenyl]piperidine-2,6-dione.
| Compound Name | 3-[2-chloro-3-[4-[5-(difluoromethyl)pyrazolo[1,5-a]pyrimidin-7-yl]piperazin-1-yl]phenyl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 178099268 |
| Molecular Formula | C22H21ClF2N6O2 |
| Molecular Weight | 474.90 g/mol |
| Exact Mass | 474.14 |
| IUPAC Name | 3-[2-chloro-3-[4-[5-(difluoromethyl)pyrazolo[1,5-a]pyrimidin-7-yl]piperazin-1-yl]phenyl]piperidine-2,6-dione |
| SMILES | O=C1CCC(c2cccc(N3CCN(c4cc(C(F)F)nc5ccnn45)CC3)c2Cl)C(=O)N1 |
| InChI | InChI=1S/C22H21ClF2N6O2/c23-20-13(14-4-5-18(32)28-22(14)33)2-1-3-16(20)29-8-10-30(11-9-29)19-12-15(21(24)25)27-17-6-7-26-31(17)19/h1-3,6-7,12,14,21H,4-5,8-11H2,(H,28,32,33) |
| InChIKey | SAUFROBPAZUGMC-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 82.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.90 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|