C22H21ClN4O3 — CID 178099418
3-[3-[4-(1,3-benzoxazol-4-yl)piperazin-1-yl]-2-chlorophenyl]piperidine-2,6-dione (PubChem CID 178099418) has the molecular formula C22H21ClN4O3 and a molecular weight of 424.89 g/mol. Its IUPAC name is 3-[3-[4-(1,3-benzoxazol-4-yl)piperazin-1-yl]-2-chlorophenyl]piperidine-2,6-dione.
| Compound Name | 3-[3-[4-(1,3-benzoxazol-4-yl)piperazin-1-yl]-2-chlorophenyl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 178099418 |
| Molecular Formula | C22H21ClN4O3 |
| Molecular Weight | 424.89 g/mol |
| Exact Mass | 424.13 |
| IUPAC Name | 3-[3-[4-(1,3-benzoxazol-4-yl)piperazin-1-yl]-2-chlorophenyl]piperidine-2,6-dione |
| SMILES | O=C1CCC(c2cccc(N3CCN(c4cccc5ocnc45)CC3)c2Cl)C(=O)N1 |
| InChI | InChI=1S/C22H21ClN4O3/c23-20-14(15-7-8-19(28)25-22(15)29)3-1-4-16(20)26-9-11-27(12-10-26)17-5-2-6-18-21(17)24-13-30-18/h1-6,13,15H,7-12H2,(H,25,28,29) |
| InChIKey | DDKCLRBPAUSZPG-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 78.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.89 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|