C21H22ClF2N5O3 — CID 178099186
3-[2-chloro-3-[4-[1-(2,2-difluoroethyl)-6-oxopyrimidin-5-yl]piperazin-1-yl]phenyl]piperidine-2,6-dione (PubChem CID 178099186) has the molecular formula C21H22ClF2N5O3 and a molecular weight of 465.89 g/mol. Its IUPAC name is 3-[2-chloro-3-[4-[1-(2,2-difluoroethyl)-6-oxopyrimidin-5-yl]piperazin-1-yl]phenyl]piperidine-2,6-dione.
| Compound Name | 3-[2-chloro-3-[4-[1-(2,2-difluoroethyl)-6-oxopyrimidin-5-yl]piperazin-1-yl]phenyl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 178099186 |
| Molecular Formula | C21H22ClF2N5O3 |
| Molecular Weight | 465.89 g/mol |
| Exact Mass | 465.14 |
| IUPAC Name | 3-[2-chloro-3-[4-[1-(2,2-difluoroethyl)-6-oxopyrimidin-5-yl]piperazin-1-yl]phenyl]piperidine-2,6-dione |
| SMILES | O=C1CCC(c2cccc(N3CCN(c4cncn(CC(F)F)c4=O)CC3)c2Cl)C(=O)N1 |
| InChI | InChI=1S/C21H22ClF2N5O3/c22-19-13(14-4-5-18(30)26-20(14)31)2-1-3-15(19)27-6-8-28(9-7-27)16-10-25-12-29(21(16)32)11-17(23)24/h1-3,10,12,14,17H,4-9,11H2,(H,26,30,31) |
| InChIKey | KIZCRYNLSYOGEU-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 87.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.89 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|