C22H20ClFN2O3 — CID 171846438
3-[2-chloro-3-[3-fluoro-4-(2-oxopiperidin-1-yl)phenyl]phenyl]piperidine-2,6-dione (PubChem CID 171846438) has the molecular formula C22H20ClFN2O3 and a molecular weight of 414.86 g/mol. Its IUPAC name is 3-[2-chloro-3-[3-fluoro-4-(2-oxopiperidin-1-yl)phenyl]phenyl]piperidine-2,6-dione.
| Compound Name | 3-[2-chloro-3-[3-fluoro-4-(2-oxopiperidin-1-yl)phenyl]phenyl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 171846438 |
| Molecular Formula | C22H20ClFN2O3 |
| Molecular Weight | 414.86 g/mol |
| Exact Mass | 414.11 |
| IUPAC Name | 3-[2-chloro-3-[3-fluoro-4-(2-oxopiperidin-1-yl)phenyl]phenyl]piperidine-2,6-dione |
| SMILES | O=C1CCC(c2cccc(-c3ccc(N4CCCCC4=O)c(F)c3)c2Cl)C(=O)N1 |
| InChI | InChI=1S/C22H20ClFN2O3/c23-21-14(4-3-5-15(21)16-8-10-19(27)25-22(16)29)13-7-9-18(17(24)12-13)26-11-2-1-6-20(26)28/h3-5,7,9,12,16H,1-2,6,8,10-11H2,(H,25,27,29) |
| InChIKey | ASSPJYHPKZGJSP-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.86 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|