C25H27ClN2O3 — CID 171846090
3-[2-chloro-3-[4-[(4,4-dimethyl-2-oxopiperidin-1-yl)methyl]phenyl]phenyl]piperidine-2,6-dione (PubChem CID 171846090) has the molecular formula C25H27ClN2O3 and a molecular weight of 438.96 g/mol. Its IUPAC name is 3-[2-chloro-3-[4-[(4,4-dimethyl-2-oxopiperidin-1-yl)methyl]phenyl]phenyl]piperidine-2,6-dione.
| Compound Name | 3-[2-chloro-3-[4-[(4,4-dimethyl-2-oxopiperidin-1-yl)methyl]phenyl]phenyl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 171846090 |
| Molecular Formula | C25H27ClN2O3 |
| Molecular Weight | 438.96 g/mol |
| Exact Mass | 438.17 |
| IUPAC Name | 3-[2-chloro-3-[4-[(4,4-dimethyl-2-oxopiperidin-1-yl)methyl]phenyl]phenyl]piperidine-2,6-dione |
| SMILES | CC1(C)CCN(Cc2ccc(-c3cccc(C4CCC(=O)NC4=O)c3Cl)cc2)C(=O)C1 |
| InChI | InChI=1S/C25H27ClN2O3/c1-25(2)12-13-28(22(30)14-25)15-16-6-8-17(9-7-16)18-4-3-5-19(23(18)26)20-10-11-21(29)27-24(20)31/h3-9,20H,10-15H2,1-2H3,(H,27,29,31) |
| InChIKey | JKUWQKSPAAOIGS-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.96 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|