C20H21ClN2O2 — CID 178099618
(3S)-3-[2-chloro-3-[4-(propan-2-ylamino)phenyl]phenyl]piperidine-2,6-dione (PubChem CID 178099618) has the molecular formula C20H21ClN2O2 and a molecular weight of 356.85 g/mol. Its IUPAC name is (3S)-3-[2-chloro-3-[4-(propan-2-ylamino)phenyl]phenyl]piperidine-2,6-dione.
| Compound Name | (3S)-3-[2-chloro-3-[4-(propan-2-ylamino)phenyl]phenyl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 178099618 |
| Molecular Formula | C20H21ClN2O2 |
| Molecular Weight | 356.85 g/mol |
| Exact Mass | 356.13 |
| IUPAC Name | (3S)-3-[2-chloro-3-[4-(propan-2-ylamino)phenyl]phenyl]piperidine-2,6-dione |
| SMILES | CC(C)Nc1ccc(-c2cccc([C@@H]3CCC(=O)NC3=O)c2Cl)cc1 |
| InChI | InChI=1S/C20H21ClN2O2/c1-12(2)22-14-8-6-13(7-9-14)15-4-3-5-16(19(15)21)17-10-11-18(24)23-20(17)25/h3-9,12,17,22H,10-11H2,1-2H3,(H,23,24,25)/t17-/m0/s1 |
| InChIKey | ZGTBQEARJXWHIC-KRWDZBQOSA-N |
| XLogP | 4.35 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.85 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|