C23H20ClF3N2O3 — CID 171846480
3-[2-chloro-3-[4-[2-oxo-6-(trifluoromethyl)piperidin-1-yl]phenyl]phenyl]piperidine-2,6-dione (PubChem CID 171846480) has the molecular formula C23H20ClF3N2O3 and a molecular weight of 464.87 g/mol. Its IUPAC name is 3-[2-chloro-3-[4-[2-oxo-6-(trifluoromethyl)piperidin-1-yl]phenyl]phenyl]piperidine-2,6-dione.
| Compound Name | 3-[2-chloro-3-[4-[2-oxo-6-(trifluoromethyl)piperidin-1-yl]phenyl]phenyl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 171846480 |
| Molecular Formula | C23H20ClF3N2O3 |
| Molecular Weight | 464.87 g/mol |
| Exact Mass | 464.11 |
| IUPAC Name | 3-[2-chloro-3-[4-[2-oxo-6-(trifluoromethyl)piperidin-1-yl]phenyl]phenyl]piperidine-2,6-dione |
| SMILES | O=C1CCC(c2cccc(-c3ccc(N4C(=O)CCCC4C(F)(F)F)cc3)c2Cl)C(=O)N1 |
| InChI | InChI=1S/C23H20ClF3N2O3/c24-21-15(3-1-4-16(21)17-11-12-19(30)28-22(17)32)13-7-9-14(10-8-13)29-18(23(25,26)27)5-2-6-20(29)31/h1,3-4,7-10,17-18H,2,5-6,11-12H2,(H,28,30,32) |
| InChIKey | GNBADQRYEKSRSG-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.87 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|