C22H18ClF3N2O4 — CID 171846600
3-[2-chloro-3-[4-[3-oxo-5-(trifluoromethyl)morpholin-4-yl]phenyl]phenyl]piperidine-2,6-dione (PubChem CID 171846600) has the molecular formula C22H18ClF3N2O4 and a molecular weight of 466.84 g/mol. Its IUPAC name is 3-[2-chloro-3-[4-[3-oxo-5-(trifluoromethyl)morpholin-4-yl]phenyl]phenyl]piperidine-2,6-dione.
| Compound Name | 3-[2-chloro-3-[4-[3-oxo-5-(trifluoromethyl)morpholin-4-yl]phenyl]phenyl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 171846600 |
| Molecular Formula | C22H18ClF3N2O4 |
| Molecular Weight | 466.84 g/mol |
| Exact Mass | 466.09 |
| IUPAC Name | 3-[2-chloro-3-[4-[3-oxo-5-(trifluoromethyl)morpholin-4-yl]phenyl]phenyl]piperidine-2,6-dione |
| SMILES | O=C1CCC(c2cccc(-c3ccc(N4C(=O)COCC4C(F)(F)F)cc3)c2Cl)C(=O)N1 |
| InChI | InChI=1S/C22H18ClF3N2O4/c23-20-14(2-1-3-15(20)16-8-9-18(29)27-21(16)31)12-4-6-13(7-5-12)28-17(22(24,25)26)10-32-11-19(28)30/h1-7,16-17H,8-11H2,(H,27,29,31) |
| InChIKey | SYHBKLMTSFSDKN-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.84 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|