C24H23ClN2O4 — CID 171845993
3-[2-chloro-3-[4-(6-oxo-2-oxa-5-azaspiro[3.5]nonan-5-yl)phenyl]phenyl]piperidine-2,6-dione (PubChem CID 171845993) has the molecular formula C24H23ClN2O4 and a molecular weight of 438.91 g/mol. Its IUPAC name is 3-[2-chloro-3-[4-(6-oxo-2-oxa-5-azaspiro[3.5]nonan-5-yl)phenyl]phenyl]piperidine-2,6-dione.
| Compound Name | 3-[2-chloro-3-[4-(6-oxo-2-oxa-5-azaspiro[3.5]nonan-5-yl)phenyl]phenyl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 171845993 |
| Molecular Formula | C24H23ClN2O4 |
| Molecular Weight | 438.91 g/mol |
| Exact Mass | 438.13 |
| IUPAC Name | 3-[2-chloro-3-[4-(6-oxo-2-oxa-5-azaspiro[3.5]nonan-5-yl)phenyl]phenyl]piperidine-2,6-dione |
| SMILES | O=C1CCC(c2cccc(-c3ccc(N4C(=O)CCCC45COC5)cc3)c2Cl)C(=O)N1 |
| InChI | InChI=1S/C24H23ClN2O4/c25-22-17(3-1-4-18(22)19-10-11-20(28)26-23(19)30)15-6-8-16(9-7-15)27-21(29)5-2-12-24(27)13-31-14-24/h1,3-4,6-9,19H,2,5,10-14H2,(H,26,28,30) |
| InChIKey | OIVARWLTKIGUCN-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.91 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|