C22H20ClN3O4 — CID 171846527
3-[2-chloro-3-[6-(5-oxo-6-oxa-4-azaspiro[2.5]octan-4-yl)-3-pyridinyl]phenyl]piperidine-2,6-dione (PubChem CID 171846527) has the molecular formula C22H20ClN3O4 and a molecular weight of 425.87 g/mol. Its IUPAC name is 3-[2-chloro-3-[6-(5-oxo-6-oxa-4-azaspiro[2.5]octan-4-yl)-3-pyridinyl]phenyl]piperidine-2,6-dione.
| Compound Name | 3-[2-chloro-3-[6-(5-oxo-6-oxa-4-azaspiro[2.5]octan-4-yl)-3-pyridinyl]phenyl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 171846527 |
| Molecular Formula | C22H20ClN3O4 |
| Molecular Weight | 425.87 g/mol |
| Exact Mass | 425.11 |
| IUPAC Name | 3-[2-chloro-3-[6-(5-oxo-6-oxa-4-azaspiro[2.5]octan-4-yl)-3-pyridinyl]phenyl]piperidine-2,6-dione |
| SMILES | O=C1CCC(c2cccc(-c3ccc(N4C(=O)OCCC45CC5)nc3)c2Cl)C(=O)N1 |
| InChI | InChI=1S/C22H20ClN3O4/c23-19-14(2-1-3-15(19)16-5-7-18(27)25-20(16)28)13-4-6-17(24-12-13)26-21(29)30-11-10-22(26)8-9-22/h1-4,6,12,16H,5,7-11H2,(H,25,27,28) |
| InChIKey | JPYPVROKHWBIMH-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.87 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|