C21H20ClN3O4 — CID 171845879
3-[2-chloro-3-[6-[(2-oxo-1,3-oxazinan-3-yl)methyl]-3-pyridinyl]phenyl]piperidine-2,6-dione (PubChem CID 171845879) has the molecular formula C21H20ClN3O4 and a molecular weight of 413.86 g/mol. Its IUPAC name is 3-[2-chloro-3-[6-[(2-oxo-1,3-oxazinan-3-yl)methyl]-3-pyridinyl]phenyl]piperidine-2,6-dione.
| Compound Name | 3-[2-chloro-3-[6-[(2-oxo-1,3-oxazinan-3-yl)methyl]-3-pyridinyl]phenyl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 171845879 |
| Molecular Formula | C21H20ClN3O4 |
| Molecular Weight | 413.86 g/mol |
| Exact Mass | 413.11 |
| IUPAC Name | 3-[2-chloro-3-[6-[(2-oxo-1,3-oxazinan-3-yl)methyl]-3-pyridinyl]phenyl]piperidine-2,6-dione |
| SMILES | O=C1CCC(c2cccc(-c3ccc(CN4CCCOC4=O)nc3)c2Cl)C(=O)N1 |
| InChI | InChI=1S/C21H20ClN3O4/c22-19-15(3-1-4-16(19)17-7-8-18(26)24-20(17)27)13-5-6-14(23-11-13)12-25-9-2-10-29-21(25)28/h1,3-6,11,17H,2,7-10,12H2,(H,24,26,27) |
| InChIKey | JAQZAWQPPJXLNG-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.86 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|