C22H23ClN4O3 — CID 171846709
3-[2-chloro-3-[6-[(3-methyl-2-oxo-1,3-diazinan-1-yl)methyl]-3-pyridinyl]phenyl]piperidine-2,6-dione (PubChem CID 171846709) has the molecular formula C22H23ClN4O3 and a molecular weight of 426.90 g/mol. Its IUPAC name is 3-[2-chloro-3-[6-[(3-methyl-2-oxo-1,3-diazinan-1-yl)methyl]-3-pyridinyl]phenyl]piperidine-2,6-dione.
| Compound Name | 3-[2-chloro-3-[6-[(3-methyl-2-oxo-1,3-diazinan-1-yl)methyl]-3-pyridinyl]phenyl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 171846709 |
| Molecular Formula | C22H23ClN4O3 |
| Molecular Weight | 426.90 g/mol |
| Exact Mass | 426.15 |
| IUPAC Name | 3-[2-chloro-3-[6-[(3-methyl-2-oxo-1,3-diazinan-1-yl)methyl]-3-pyridinyl]phenyl]piperidine-2,6-dione |
| SMILES | CN1CCCN(Cc2ccc(-c3cccc(C4CCC(=O)NC4=O)c3Cl)cn2)C1=O |
| InChI | InChI=1S/C22H23ClN4O3/c1-26-10-3-11-27(22(26)30)13-15-7-6-14(12-24-15)16-4-2-5-17(20(16)23)18-8-9-19(28)25-21(18)29/h2,4-7,12,18H,3,8-11,13H2,1H3,(H,25,28,29) |
| InChIKey | RZZVXQBQIPXBRC-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 82.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.90 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|