C23H21ClN4O3 — CID 171845915
N-[4-[2-chloro-3-(2,6-dioxopiperidin-3-yl)phenyl]phenyl]-N,1-dimethylpyrazole-3-carboxamide (PubChem CID 171845915) has the molecular formula C23H21ClN4O3 and a molecular weight of 436.90 g/mol. Its IUPAC name is N-[4-[2-chloro-3-(2,6-dioxopiperidin-3-yl)phenyl]phenyl]-N,1-dimethylpyrazole-3-carboxamide.
| Compound Name | N-[4-[2-chloro-3-(2,6-dioxopiperidin-3-yl)phenyl]phenyl]-N,1-dimethylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 171845915 |
| Molecular Formula | C23H21ClN4O3 |
| Molecular Weight | 436.90 g/mol |
| Exact Mass | 436.13 |
| IUPAC Name | N-[4-[2-chloro-3-(2,6-dioxopiperidin-3-yl)phenyl]phenyl]-N,1-dimethylpyrazole-3-carboxamide |
| SMILES | CN(C(=O)c1ccn(C)n1)c1ccc(-c2cccc(C3CCC(=O)NC3=O)c2Cl)cc1 |
| InChI | InChI=1S/C23H21ClN4O3/c1-27-13-12-19(26-27)23(31)28(2)15-8-6-14(7-9-15)16-4-3-5-17(21(16)24)18-10-11-20(29)25-22(18)30/h3-9,12-13,18H,10-11H2,1-2H3,(H,25,29,30) |
| InChIKey | XUNRYQANAPAPPJ-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.90 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|