C23H20ClFN2O3 — CID 171846545
N-[4-[2-chloro-3-(2,6-dioxopiperidin-3-yl)phenyl]phenyl]-N-[(1E)-1-fluorobuta-1,3-dienyl]acetamide (PubChem CID 171846545) has the molecular formula C23H20ClFN2O3 and a molecular weight of 426.88 g/mol. Its IUPAC name is N-[4-[2-chloro-3-(2,6-dioxopiperidin-3-yl)phenyl]phenyl]-N-[(1E)-1-fluorobuta-1,3-dienyl]acetamide.
| Compound Name | N-[4-[2-chloro-3-(2,6-dioxopiperidin-3-yl)phenyl]phenyl]-N-[(1E)-1-fluorobuta-1,3-dienyl]acetamide |
|---|---|
| PubChem CID | 171846545 |
| Molecular Formula | C23H20ClFN2O3 |
| Molecular Weight | 426.88 g/mol |
| Exact Mass | 426.11 |
| IUPAC Name | N-[4-[2-chloro-3-(2,6-dioxopiperidin-3-yl)phenyl]phenyl]-N-[(1E)-1-fluorobuta-1,3-dienyl]acetamide |
| SMILES | C=C/C=C(/F)N(C(C)=O)c1ccc(-c2cccc(C3CCC(=O)NC3=O)c2Cl)cc1 |
| InChI | InChI=1S/C23H20ClFN2O3/c1-3-5-20(25)27(14(2)28)16-10-8-15(9-11-16)17-6-4-7-18(22(17)24)19-12-13-21(29)26-23(19)30/h3-11,19H,1,12-13H2,2H3,(H,26,29,30)/b20-5- |
| InChIKey | MBETYLNMSPPAGL-SDPNRITHSA-N |
| XLogP | 4.88 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.88 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|