C18H19ClN4O3 — CID 178070637
3-[2-chloro-3-[1-(oxan-2-yl)triazol-4-yl]phenyl]piperidine-2,6-dione (PubChem CID 178070637) has the molecular formula C18H19ClN4O3 and a molecular weight of 374.83 g/mol. Its IUPAC name is 3-[2-chloro-3-[1-(oxan-2-yl)triazol-4-yl]phenyl]piperidine-2,6-dione.
| Compound Name | 3-[2-chloro-3-[1-(oxan-2-yl)triazol-4-yl]phenyl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 178070637 |
| Molecular Formula | C18H19ClN4O3 |
| Molecular Weight | 374.83 g/mol |
| Exact Mass | 374.11 |
| IUPAC Name | 3-[2-chloro-3-[1-(oxan-2-yl)triazol-4-yl]phenyl]piperidine-2,6-dione |
| SMILES | O=C1CCC(c2cccc(-c3cn(C4CCCCO4)nn3)c2Cl)C(=O)N1 |
| InChI | InChI=1S/C18H19ClN4O3/c19-17-11(12-7-8-15(24)20-18(12)25)4-3-5-13(17)14-10-23(22-21-14)16-6-1-2-9-26-16/h3-5,10,12,16H,1-2,6-9H2,(H,20,24,25) |
| InChIKey | MVSQMSIPBOAABF-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 86.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.83 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|