C13H10N2O4 — CID 97303764
4-[(3S)-2,6-dioxopiperidin-3-yl]isoindole-1,3-dione (PubChem CID 97303764) has the molecular formula C13H10N2O4 and a molecular weight of 258.23 g/mol. Its IUPAC name is 4-[(3S)-2,6-dioxopiperidin-3-yl]isoindole-1,3-dione.
| Compound Name | 4-[(3S)-2,6-dioxopiperidin-3-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 97303764 |
| Molecular Formula | C13H10N2O4 |
| Molecular Weight | 258.23 g/mol |
| Exact Mass | 258.06 |
| IUPAC Name | 4-[(3S)-2,6-dioxopiperidin-3-yl]isoindole-1,3-dione |
| SMILES | O=C1CC[C@@H](c2cccc3c2C(=O)NC3=O)C(=O)N1 |
| InChI | InChI=1S/C13H10N2O4/c16-9-5-4-7(11(17)14-9)6-2-1-3-8-10(6)13(19)15-12(8)18/h1-3,7H,4-5H2,(H,14,16,17)(H,15,18,19)/t7-/m0/s1 |
| InChIKey | JDRKRVCGVDJGQL-ZETCQYMHSA-N |
| XLogP | 0.09 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.23 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|