C11H9NO2 — CID 54298107
4-cyclopropylisoindole-1,3-dione (PubChem CID 54298107) has the molecular formula C11H9NO2 and a molecular weight of 187.20 g/mol. Its IUPAC name is 4-cyclopropylisoindole-1,3-dione.
| Compound Name | 4-cyclopropylisoindole-1,3-dione |
|---|---|
| PubChem CID | 54298107 |
| Molecular Formula | C11H9NO2 |
| Molecular Weight | 187.20 g/mol |
| Exact Mass | 187.06 |
| IUPAC Name | 4-cyclopropylisoindole-1,3-dione |
| SMILES | O=C1NC(=O)c2c1cccc2C1CC1 |
| InChI | InChI=1S/C11H9NO2/c13-10-8-3-1-2-7(6-4-5-6)9(8)11(14)12-10/h1-3,6H,4-5H2,(H,12,13,14) |
| InChIKey | QTYSEGSANHQLOF-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.20 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|