C12H9NO2 — CID 158098721
4-(cyclobuten-1-yl)isoindole-1,3-dione (PubChem CID 158098721) has the molecular formula C12H9NO2 and a molecular weight of 199.21 g/mol. Its IUPAC name is 4-(cyclobuten-1-yl)isoindole-1,3-dione.
| Compound Name | 4-(cyclobuten-1-yl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 158098721 |
| Molecular Formula | C12H9NO2 |
| Molecular Weight | 199.21 g/mol |
| Exact Mass | 199.06 |
| IUPAC Name | 4-(cyclobuten-1-yl)isoindole-1,3-dione |
| SMILES | O=C1NC(=O)c2c1cccc2C1=CCC1 |
| InChI | InChI=1S/C12H9NO2/c14-11-9-6-2-5-8(7-3-1-4-7)10(9)12(15)13-11/h2-3,5-6H,1,4H2,(H,13,14,15) |
| InChIKey | FOZIWFGUVZTUSM-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.21 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|