C24H16N2O4 — CID 142702251
4-[3-(1,3-dioxoisoindol-4-yl)-2,4-dimethylphenyl]isoindole-1,3-dione (PubChem CID 142702251) has the molecular formula C24H16N2O4 and a molecular weight of 396.40 g/mol. Its IUPAC name is 4-[3-(1,3-dioxoisoindol-4-yl)-2,4-dimethylphenyl]isoindole-1,3-dione.
| Compound Name | 4-[3-(1,3-dioxoisoindol-4-yl)-2,4-dimethylphenyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 142702251 |
| Molecular Formula | C24H16N2O4 |
| Molecular Weight | 396.40 g/mol |
| Exact Mass | 396.11 |
| IUPAC Name | 4-[3-(1,3-dioxoisoindol-4-yl)-2,4-dimethylphenyl]isoindole-1,3-dione |
| SMILES | Cc1ccc(-c2cccc3c2C(=O)NC3=O)c(C)c1-c1cccc2c1C(=O)NC2=O |
| InChI | InChI=1S/C24H16N2O4/c1-11-9-10-13(14-5-3-7-16-19(14)23(29)25-21(16)27)12(2)18(11)15-6-4-8-17-20(15)24(30)26-22(17)28/h3-10H,1-2H3,(H,25,27,29)(H,26,28,30) |
| InChIKey | ZCLXEYSRKTWATO-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.40 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|