C16H18N2O4 — CID 155707467
piperidine-2,6-dione;4-propan-2-ylisoindole-1,3-dione (PubChem CID 155707467) has the molecular formula C16H18N2O4 and a molecular weight of 302.33 g/mol. Its IUPAC name is piperidine-2,6-dione;4-propan-2-ylisoindole-1,3-dione.
| Compound Name | piperidine-2,6-dione;4-propan-2-ylisoindole-1,3-dione |
|---|---|
| PubChem CID | 155707467 |
| Molecular Formula | C16H18N2O4 |
| Molecular Weight | 302.33 g/mol |
| Exact Mass | 302.13 |
| IUPAC Name | piperidine-2,6-dione;4-propan-2-ylisoindole-1,3-dione |
| SMILES | CC(C)c1cccc2c1C(=O)NC2=O.O=C1CCCC(=O)N1 |
| InChI | InChI=1S/C11H11NO2.C5H7NO2/c1-6(2)7-4-3-5-8-9(7)11(14)12-10(8)13;7-4-2-1-3-5(8)6-4/h3-6H,1-2H3,(H,12,13,14);1-3H2,(H,6,7,8) |
| InChIKey | BFDRVSWDYQBOFV-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.33 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|