C20H21NO2 — CID 67700217
4-(1-phenylhexyl)isoindole-1,3-dione (PubChem CID 67700217) has the molecular formula C20H21NO2 and a molecular weight of 307.39 g/mol. Its IUPAC name is 4-(1-phenylhexyl)isoindole-1,3-dione.
| Compound Name | 4-(1-phenylhexyl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 67700217 |
| Molecular Formula | C20H21NO2 |
| Molecular Weight | 307.39 g/mol |
| Exact Mass | 307.16 |
| IUPAC Name | 4-(1-phenylhexyl)isoindole-1,3-dione |
| SMILES | CCCCCC(c1ccccc1)c1cccc2c1C(=O)NC2=O |
| InChI | InChI=1S/C20H21NO2/c1-2-3-5-11-15(14-9-6-4-7-10-14)16-12-8-13-17-18(16)20(23)21-19(17)22/h4,6-10,12-13,15H,2-3,5,11H2,1H3,(H,21,22,23) |
| InChIKey | HCPAGTSIJWYEFT-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.39 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|