C13H10NO4P — CID 139644569
4-[(5E,7Z)-4H-1,3,2-dioxaphosphocin-6-yl]isoindole-1,3-dione (PubChem CID 139644569) has the molecular formula C13H10NO4P and a molecular weight of 275.20 g/mol. Its IUPAC name is 4-[(5E,7Z)-4H-1,3,2-dioxaphosphocin-6-yl]isoindole-1,3-dione.
| Compound Name | 4-[(5E,7Z)-4H-1,3,2-dioxaphosphocin-6-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 139644569 |
| Molecular Formula | C13H10NO4P |
| Molecular Weight | 275.20 g/mol |
| Exact Mass | 275.03 |
| IUPAC Name | 4-[(5E,7Z)-4H-1,3,2-dioxaphosphocin-6-yl]isoindole-1,3-dione |
| SMILES | O=C1NC(=O)c2c1cccc2C1=C/COPO/C=C\1 |
| InChI | InChI=1S/C13H10NO4P/c15-12-10-3-1-2-9(11(10)13(16)14-12)8-4-6-17-19-18-7-5-8/h1-6,19H,7H2,(H,14,15,16)/b6-4-,8-5+ |
| InChIKey | INDODPRSTFXROU-QXMOYCCXSA-N |
| XLogP | 2.02 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.20 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|